jiosephlee/acute-toxicity-classification-10-bins

prompt stringlengths 319 491	completion stringclasses 10 values	smiles stringlengths 2 174	toxicity_value float64 -0.34 10.2	label int64 1 10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=P(OCCCl)(OCCCl)OCCCl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	O=P(OCCCl)(OCCCl)OCCCl	2.366	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1Br Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1Br	1.563	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1	2.354	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(=O)OC1=C(OC(=O)CC)C(=O)OC1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	CCC(=O)OC1=C(OC(=O)CC)C(=O)OC1=O	1.685	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCCN(N=O)C(N)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	CCCCCN(N=O)C(N)=O	2.454	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(Oc1cnn(-c2ccccc2)c(=O)c1OC)OC(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CCOP(=S)(Oc1cnn(-c2ccccc2)c(=O)c1OC)OC(C)C	4.439	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(C(=O)C(C)C(O)C(C)CCc1ccc(C)c(O)c1C(=O)O)C1OC(CC)(C2CCC(O)(CC)C(C)O2)CC1C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	CCC(C(=O)C(C)C(O)C(C)CCc1ccc(C)c(O)c1C(=O)O)C1OC(CC)(C2CCC(O)(CC)C(C)O2)CC1C	3.685	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)CNC(=S)NCC(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	CC(C)CNC(=S)NCC(C)C	2.372	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Nc1nc(=S)ss1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	Nc1nc(=S)ss1	1.693	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCOC(=O)c1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1C(=O)OCCCC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	CCCCOC(=O)c1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1C(=O)OCCCC	1.67	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21	2.908	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C1CNCCN1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	C1CNCCN1	1.656	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2	1.765	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)OC(=O)C(Cl)(Cl)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	CC(C)OC(=O)C(Cl)(Cl)Cl	1.67	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=c1ccc2ccccc2o1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 7	O=c1ccc2ccccc2o1	2.698	7
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCNCCC[Si](OC)(OC)OC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	CCCCNCCC[Si](OC)(OC)OC	1.265	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=O)OCC(C(OC(C)=O)c1ccccc1)[N+](=O)[O-] Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CC(=O)OCC(C(OC(C)=O)c1ccccc1)[N+](=O)[O-]	1.939	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCOC(C)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	COCCOC(C)=O	1.542	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=CCSc1nnc(CSP(=S)(OC)OC)s1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	C=CCSc1nnc(CSP(=S)(OC)OC)s1	2.33	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 7	CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O	2.61	7
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: N#Cc1ccc(Cl)c([N+](=O)[O-])c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	N#Cc1ccc(Cl)c([N+](=O)[O-])c1	1.95	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])c(Cl)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])c(Cl)c1	3.814	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CCc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1	1.757	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C[Si](C)(C)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	C[Si](C)(C)Cl	1.351	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1c(F)c(F)c2[nH]c(C(F)(F)F)nc2c1F Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	Cc1c(F)c(F)c2[nH]c(C(F)(F)F)nc2c1F	4.81	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCN(CC)C(=O)c1ccccc1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	CCN(CC)C(=O)c1ccccc1O	2.523	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1ccc2c(=O)c(C)c(-c3ccccc3)oc2c1CN(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	COc1ccc2c(=O)c(C)c(-c3ccccc3)oc2c1CN(C)C	3.908	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCC[Si](OC)(OC)OC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	CCCCC[Si](OC)(OC)OC	1.592	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CS(=O)(=O)NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	CS(=O)(=O)NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-]	2.545	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(Cl)OCC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 4	CCOP(=S)(Cl)OCC	2.148	4
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl	5.225	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O	1.854	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COP(N)(=S)Oc1cc(Cl)c(Cl)cc1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 7	COP(N)(=S)Oc1cc(Cl)c(Cl)cc1Cl	2.641	7
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN(CCC#N)CCC#N Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	CN(CCC#N)CCC#N	2.188	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CNC(=O)ON=C1SCSC1(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CNC(=O)ON=C1SCSC1(C)C	5.517	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CNN=Nc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	CNN=Nc1ccccc1	2.508	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=CCOC=C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	C=CCOC=C	2.185	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCCNc1nc(NC(C)C)nc(SC)n1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	COCCCNc1nc(NC(C)C)nc(SC)n1	1.735	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=O)Nc1cc(Cl)c([N+](=O)[O-])cc1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CC(=O)Nc1cc(Cl)c([N+](=O)[O-])cc1Cl	1.945	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCN(CC)CCOCc1cc(Br)cc(Br)c1OC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CCN(CC)CCOCc1cc(Br)cc(Br)c1OC	2.898	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCN1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	COCCN1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1	2.905	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC1(CC)C(=O)C=CN(CN2CCNCC2)C1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	CCC1(CC)C(=O)C=CN(CN2CCNCC2)C1=O	2.297	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O	3.186	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOC(=O)NNc1nncc2ccccc12 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 7	CCOC(=O)NNc1nncc2ccccc12	2.864	7
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=Cc1ccc([N+](=O)[O-])cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	O=Cc1ccc([N+](=O)[O-])cc1	1.507	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CNC(=O)Nc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	CNC(=O)Nc1ccccc1	1.64	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(F)(F)F)c(Cl)s1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(F)(F)F)c(Cl)s1	2.96	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Brc1nc(Br)c(Br)[nH]1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	Brc1nc(Br)c(Br)[nH]1	3.952	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 4	CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1	2.044	4
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCC(c1ccc(CCCl)cc1)c1c(O)c2ccccc2oc1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CCCC(c1ccc(CCCl)cc1)c1c(O)c2ccccc2oc1=O	4.297	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C(O)CC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	O=C(O)CC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O	2.527	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN(C)c1nc(N(C)C)nc(N(C)C)n1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 7	CN(C)c1nc(N(C)C)nc(N(C)C)n1	2.779	7
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1cc(O)c(C(=O)c2ccccc2)cc1S(=O)(=O)O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	COc1cc(O)c(C(=O)c2ccccc2)cc1S(=O)(=O)O	1.941	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(CC)Oc1cc(Cl)ccc1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CCOP(=S)(CC)Oc1cc(Cl)ccc1Cl	4.197	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1	3.39	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC1(COCCOCC2(C)CO2)CO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	CC1(COCCOCC2(C)CO2)CO1	1.433	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COP(C)(=S)SCn1c(=O)oc2cccnc21 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	COP(C)(=S)SCn1c(=O)oc2cccnc21	2.22	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: [O-][n+]1c2ccccc2nc2ccccc21 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	[O-][n+]1c2ccccc2nc2ccccc21	1.473	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Fc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	Fc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl	5.11	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCC(CC)COC(CBr)c1cccc(C2CCCCC2)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CCCCC(CC)COC(CBr)c1cccc(C2CCCCC2)c1	3.199	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C(NCCO[N+](=O)[O-])c1cccnc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	O=C(NCCO[N+](=O)[O-])c1cccnc1	2.238	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCC(C)COC(C)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	CCCC(C)COC(C)=O	1.29	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCC(=O)C(CC)Cc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	CCCC(=O)C(CC)Cc1ccccc1	1.667	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2	3.001	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1nnc(CSP(=S)(OC)OC)s1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	COc1nnc(CSP(=S)(OC)OC)s1	2.93	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCC1CO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	COCC1CO1	2.284	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Nc1cc([N+](=O)[O-])ccc1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	Nc1cc([N+](=O)[O-])ccc1O	1.808	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=CC(=O)OCCO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	C=CC(=O)OCCO	2.252	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(O)C1CC=CCC1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CC(O)C1CC=CCC1	1.952	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCNc1nnc(-c2ccccc2)c2ccccc12 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 7	CCCNc1nnc(-c2ccccc2)c2ccccc12	2.703	7
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=COCCOCC1CO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	C=COCCOCC1CO1	1.771	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC	3.466	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)NC(=O)OCC(O)C1COc2ccccc2O1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	CC(C)NC(=O)OCC(O)C1COc2ccccc2O1	2.273	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)CC=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	CC(C)CC=O	1.187	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)(C)OOC(=O)c1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	CC(C)(C)OOC(=O)c1ccccc1	2.283	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=[N+]([O-])c1ccc(CCl)cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 4	O=[N+]([O-])c1ccc(CCl)cc1	1.977	4
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C#CCN(CC)CC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	C#CCN(CC)CC	1.859	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C1COCO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	C1COCO1	1.393	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(CC)Sc1ccccc1C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	CCOP(=S)(CC)Sc1ccccc1C	3.782	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1ncc(CO)c(CO)c1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	Cc1ncc(CO)c(CO)c1O	1.626	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCSC(=S)N(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	CCSC(=S)N(C)C	2.434	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCSCCO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	COCCSCCO	1.02	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOC(C1=NCC(C)(CC)CN1)c1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CCOC(C1=NCC(C)(CC)CN1)c1ccccc1	3.073	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(Oc1cnn(CC)c(=O)c1OC)OC(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CCOP(=S)(Oc1cnn(CC)c(=O)c1OC)OC(C)C	4.97	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=N)NP(=S)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 10	CC(=N)NP(=S)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1	5.006	10
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=Cc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	O=Cc1ccccc1	1.912	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCS(=O)(=O)CCO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	CCS(=O)(=O)CCO	0.885	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(C)OC(CBr)c1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 8	CCC(C)OC(CBr)c1ccccc1	3.012	8
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CC(C)(c1ccc(O)cc1)c1ccc(O)cc1	1.847	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: NC(=O)Cc1c([O-])on[n+]1Cc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	NC(=O)Cc1c([O-])on[n+]1Cc1ccccc1	1.719	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O	1.867	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 4	COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1	2.099	4
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=Cc1ccccc1)CC(=O)NC1CCCCC1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	CC(=Cc1ccccc1)CC(=O)NC1CCCCC1	1.933	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: ClCCC(Cl)(Cl)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 6	ClCCC(Cl)(Cl)Cl	2.57	6
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(CO)(CO)CO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 1	CCC(CO)(CO)CO	0.978	1
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 9	O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1	3.61	9
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: NC(=O)c1c(F)cccc1F Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 2	NC(=O)c1c(F)cccc1F	1.678	2
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 3	Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1	1.787	3
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC[Si](N(C)C)(N(C)C)N(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 5	CC[Si](N(C)C)(N(C)C)N(C)C	2.245	5
Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1ccc(C(=O)CCC(=O)O)c2ccccc12 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.	Toxicity Class: 4	COc1ccc(C(=O)CCC(=O)O)c2ccccc12	2.157	4

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=P(OCCCl)(OCCCl)OCCCl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

O=P(OCCCl)(OCCCl)OCCCl

2.366

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1Br Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1Br

1.563

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1

2.354

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(=O)OC1=C(OC(=O)CC)C(=O)OC1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

CCC(=O)OC1=C(OC(=O)CC)C(=O)OC1=O

1.685

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCCN(N=O)C(N)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

CCCCCN(N=O)C(N)=O

2.454

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(Oc1cnn(-c2ccccc2)c(=O)c1OC)OC(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CCOP(=S)(Oc1cnn(-c2ccccc2)c(=O)c1OC)OC(C)C

4.439

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(C(=O)C(C)C(O)C(C)CCc1ccc(C)c(O)c1C(=O)O)C1OC(CC)(C2CCC(O)(CC)C(C)O2)CC1C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

CCC(C(=O)C(C)C(O)C(C)CCc1ccc(C)c(O)c1C(=O)O)C1OC(CC)(C2CCC(O)(CC)C(C)O2)CC1C

3.685

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)CNC(=S)NCC(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

CC(C)CNC(=S)NCC(C)C

2.372

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Nc1nc(=S)ss1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

Nc1nc(=S)ss1

1.693

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCOC(=O)c1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1C(=O)OCCCC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

CCCCOC(=O)c1ccccc1C(=O)OCCOCCOC(=O)c1ccccc1C(=O)OCCCC

1.67

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21

2.908

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C1CNCCN1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

C1CNCCN1

1.656

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2

1.765

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)OC(=O)C(Cl)(Cl)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

CC(C)OC(=O)C(Cl)(Cl)Cl

1.67

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=c1ccc2ccccc2o1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 7

O=c1ccc2ccccc2o1

2.698

7

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCNCCC[Si](OC)(OC)OC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

CCCCNCCC[Si](OC)(OC)OC

1.265

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=O)OCC(C(OC(C)=O)c1ccccc1)[N+](=O)[O-] Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CC(=O)OCC(C(OC(C)=O)c1ccccc1)[N+](=O)[O-]

1.939

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCOC(C)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

COCCOC(C)=O

1.542

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=CCSc1nnc(CSP(=S)(OC)OC)s1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

C=CCSc1nnc(CSP(=S)(OC)OC)s1

2.33

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 7

CCC(C)n1c(=O)[nH]c(C)c(Br)c1=O

2.61

7

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: N#Cc1ccc(Cl)c([N+](=O)[O-])c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

N#Cc1ccc(Cl)c([N+](=O)[O-])c1

1.95

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])c(Cl)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])c(Cl)c1

3.814

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CCc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1

1.757

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C[Si](C)(C)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

C[Si](C)(C)Cl

1.351

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1c(F)c(F)c2[nH]c(C(F)(F)F)nc2c1F Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

Cc1c(F)c(F)c2[nH]c(C(F)(F)F)nc2c1F

4.81

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCN(CC)C(=O)c1ccccc1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

CCN(CC)C(=O)c1ccccc1O

2.523

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1ccc2c(=O)c(C)c(-c3ccccc3)oc2c1CN(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

COc1ccc2c(=O)c(C)c(-c3ccccc3)oc2c1CN(C)C

3.908

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCC[Si](OC)(OC)OC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

CCCCC[Si](OC)(OC)OC

1.592

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CS(=O)(=O)NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

CS(=O)(=O)NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-]

2.545

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(Cl)OCC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 4

CCOP(=S)(Cl)OCC

2.148

4

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl

5.225

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O

1.854

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COP(N)(=S)Oc1cc(Cl)c(Cl)cc1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 7

COP(N)(=S)Oc1cc(Cl)c(Cl)cc1Cl

2.641

7

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN(CCC#N)CCC#N Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

CN(CCC#N)CCC#N

2.188

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CNC(=O)ON=C1SCSC1(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CNC(=O)ON=C1SCSC1(C)C

5.517

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CNN=Nc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

CNN=Nc1ccccc1

2.508

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=CCOC=C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

C=CCOC=C

2.185

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCCNc1nc(NC(C)C)nc(SC)n1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

COCCCNc1nc(NC(C)C)nc(SC)n1

1.735

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=O)Nc1cc(Cl)c([N+](=O)[O-])cc1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CC(=O)Nc1cc(Cl)c([N+](=O)[O-])cc1Cl

1.945

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCN(CC)CCOCc1cc(Br)cc(Br)c1OC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CCN(CC)CCOCc1cc(Br)cc(Br)c1OC

2.898

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCN1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

COCCN1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1

2.905

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC1(CC)C(=O)C=CN(CN2CCNCC2)C1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

CCC1(CC)C(=O)C=CN(CN2CCNCC2)C1=O

2.297

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O

3.186

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOC(=O)NNc1nncc2ccccc12 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 7

CCOC(=O)NNc1nncc2ccccc12

2.864

7

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=Cc1ccc([N+](=O)[O-])cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

O=Cc1ccc([N+](=O)[O-])cc1

1.507

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CNC(=O)Nc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

CNC(=O)Nc1ccccc1

1.64

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(F)(F)F)c(Cl)s1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(F)(F)F)c(Cl)s1

2.96

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Brc1nc(Br)c(Br)[nH]1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

Brc1nc(Br)c(Br)[nH]1

3.952

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 4

CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1

2.044

4

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCC(c1ccc(CCCl)cc1)c1c(O)c2ccccc2oc1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CCCC(c1ccc(CCCl)cc1)c1c(O)c2ccccc2oc1=O

4.297

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C(O)CC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

O=C(O)CC(NC(=O)COc1ccc(Cl)cc1Cl)C(=O)O

2.527

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN(C)c1nc(N(C)C)nc(N(C)C)n1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 7

CN(C)c1nc(N(C)C)nc(N(C)C)n1

2.779

7

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1cc(O)c(C(=O)c2ccccc2)cc1S(=O)(=O)O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

COc1cc(O)c(C(=O)c2ccccc2)cc1S(=O)(=O)O

1.941

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(CC)Oc1cc(Cl)ccc1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CCOP(=S)(CC)Oc1cc(Cl)ccc1Cl

4.197

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

O=C(O)CCC(=O)c1ccc(C2CCCCC2)c(Cl)c1

3.39

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC1(COCCOCC2(C)CO2)CO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

CC1(COCCOCC2(C)CO2)CO1

1.433

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COP(C)(=S)SCn1c(=O)oc2cccnc21 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

COP(C)(=S)SCn1c(=O)oc2cccnc21

2.22

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: [O-][n+]1c2ccccc2nc2ccccc21 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

[O-][n+]1c2ccccc2nc2ccccc21

1.473

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Fc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

Fc1c(Cl)c(Cl)c2nc(C(F)(F)F)[nH]c2c1Cl

5.11

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCCC(CC)COC(CBr)c1cccc(C2CCCCC2)c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CCCCC(CC)COC(CBr)c1cccc(C2CCCCC2)c1

3.199

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=C(NCCO[N+](=O)[O-])c1cccnc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

O=C(NCCO[N+](=O)[O-])c1cccnc1

2.238

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCC(C)COC(C)=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

CCCC(C)COC(C)=O

1.29

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCC(=O)C(CC)Cc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

CCCC(=O)C(CC)Cc1ccccc1

1.667

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2

3.001

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1nnc(CSP(=S)(OC)OC)s1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

COc1nnc(CSP(=S)(OC)OC)s1

2.93

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCC1CO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

COCC1CO1

2.284

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Nc1cc([N+](=O)[O-])ccc1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

Nc1cc([N+](=O)[O-])ccc1O

1.808

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=CC(=O)OCCO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

C=CC(=O)OCCO

2.252

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(O)C1CC=CCC1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CC(O)C1CC=CCC1

1.952

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCCNc1nnc(-c2ccccc2)c2ccccc12 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 7

CCCNc1nnc(-c2ccccc2)c2ccccc12

2.703

7

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C=COCCOCC1CO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

C=COCCOCC1CO1

1.771

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC

3.466

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)NC(=O)OCC(O)C1COc2ccccc2O1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

CC(C)NC(=O)OCC(O)C1COc2ccccc2O1

2.273

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)CC=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

CC(C)CC=O

1.187

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)(C)OOC(=O)c1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

CC(C)(C)OOC(=O)c1ccccc1

2.283

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=[N+]([O-])c1ccc(CCl)cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 4

O=[N+]([O-])c1ccc(CCl)cc1

1.977

4

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C#CCN(CC)CC Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

C#CCN(CC)CC

1.859

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: C1COCO1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

C1COCO1

1.393

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(CC)Sc1ccccc1C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

CCOP(=S)(CC)Sc1ccccc1C

3.782

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1ncc(CO)c(CO)c1O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

Cc1ncc(CO)c(CO)c1O

1.626

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCSC(=S)N(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

CCSC(=S)N(C)C

2.434

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COCCSCCO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

COCCSCCO

1.02

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOC(C1=NCC(C)(CC)CN1)c1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CCOC(C1=NCC(C)(CC)CN1)c1ccccc1

3.073

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCOP(=S)(Oc1cnn(CC)c(=O)c1OC)OC(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CCOP(=S)(Oc1cnn(CC)c(=O)c1OC)OC(C)C

4.97

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=N)NP(=S)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 10

CC(=N)NP(=S)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1

5.006

10

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=Cc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

O=Cc1ccccc1

1.912

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCS(=O)(=O)CCO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

CCS(=O)(=O)CCO

0.885

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(C)OC(CBr)c1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 8

CCC(C)OC(CBr)c1ccccc1

3.012

8

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CC(C)(c1ccc(O)cc1)c1ccc(O)cc1

1.847

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: NC(=O)Cc1c([O-])on[n+]1Cc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

NC(=O)Cc1c([O-])on[n+]1Cc1ccccc1

1.719

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O

1.867

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 4

COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1

2.099

4

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC(=Cc1ccccc1)CC(=O)NC1CCCCC1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

CC(=Cc1ccccc1)CC(=O)NC1CCCCC1

1.933

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: ClCCC(Cl)(Cl)Cl Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 6

ClCCC(Cl)(Cl)Cl

2.57

6

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CCC(CO)(CO)CO Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 1

CCC(CO)(CO)CO

0.978

1

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 9

O=[N+]([O-])c1cnc(Cl)c([N+](=O)[O-])c1

3.61

9

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: NC(=O)c1c(F)cccc1F Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 2

NC(=O)c1c(F)cccc1F

1.678

2

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 3

Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1

1.787

3

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: CC[Si](N(C)C)(N(C)C)N(C)C Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 5

CC[Si](N(C)C)(N(C)C)N(C)C

2.245

5

Task: Assess the Acute Toxicity (Oral Rat LD50) of the following molecule on a scale of 1 to 10. Scale Definition: 1 is least toxic (safest 10%), 10 is most toxic (deadliest 10%). Molecule: COc1ccc(C(=O)CCC(=O)O)c2ccccc12 Instructions: Analyze the molecule and estimate its toxicity level using any scientific or chemistry knowledge you may have.

Toxicity Class: 4

COc1ccc(C(=O)CCC(=O)O)c2ccccc12

2.157

4